C14H22O4 — CID 103027520
1-(2,5-dimethoxyphenyl)-3-methoxy-3-methylbutan-1-ol (PubChem CID 103027520) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-methoxy-3-methylbutan-1-ol.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-methoxy-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 103027520 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-methoxy-3-methylbutan-1-ol |
| SMILES | COc1ccc(OC)c(C(O)CC(C)(C)OC)c1 |
| InChI | InChI=1S/C14H22O4/c1-14(2,18-5)9-12(15)11-8-10(16-3)6-7-13(11)17-4/h6-8,12,15H,9H2,1-5H3 |
| InChIKey | XCZPLKPEGGTNOI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |