C24H36BrNO4Si — CID 138374083
(3S,4R)-1-bromo-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[5-[(4-methoxyphenyl)methoxy]pent-3-yn-2-yl]azetidin-2-one (PubChem CID 138374083) has the molecular formula C24H36BrNO4Si and a molecular weight of 510.55 g/mol. Its IUPAC name is (3S,4R)-1-bromo-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[5-[(4-methoxyphenyl)methoxy]pent-3-yn-2-yl]azetidin-2-one.
| Compound Name | (3S,4R)-1-bromo-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[5-[(4-methoxyphenyl)methoxy]pent-3-yn-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 138374083 |
| Molecular Formula | C24H36BrNO4Si |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (3S,4R)-1-bromo-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[5-[(4-methoxyphenyl)methoxy]pent-3-yn-2-yl]azetidin-2-one |
| SMILES | COc1ccc(COCC#CC(C)[C@@H]2[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N2Br)cc1 |
| InChI | InChI=1S/C24H36BrNO4Si/c1-17(10-9-15-29-16-19-11-13-20(28-6)14-12-19)22-21(23(27)26(22)25)18(2)30-31(7,8)24(3,4)5/h11-14,17-18,21-22H,15-16H2,1-8H3/t17?,18-,21-,22-/m1/s1 |
| InChIKey | SQTNFBJZGNVPKT-WKDJJAKYSA-N |
| XLogP | 5.40 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|