C15H24BrF2NO2Si — CID 162535644
N-(2-bromo-2,2-difluoroethyl)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline (PubChem CID 162535644) has the molecular formula C15H24BrF2NO2Si and a molecular weight of 396.35 g/mol. Its IUPAC name is N-(2-bromo-2,2-difluoroethyl)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline.
| Compound Name | N-(2-bromo-2,2-difluoroethyl)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline |
|---|---|
| PubChem CID | 162535644 |
| Molecular Formula | C15H24BrF2NO2Si |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(2-bromo-2,2-difluoroethyl)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline |
| SMILES | COc1ccc(NCC(F)(F)Br)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24BrF2NO2Si/c1-14(2,3)22(5,6)21-13-9-11(20-4)7-8-12(13)19-10-15(16,17)18/h7-9,19H,10H2,1-6H3 |
| InChIKey | KUBYMKGJUCRGAM-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|