C28H46O3Si — CID 11826635
(2E,6E,10Z)-12-[2-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-ol (PubChem CID 11826635) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is (2E,6E,10Z)-12-[2-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10Z)-12-[2-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 11826635 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (2E,6E,10Z)-12-[2-[tert-butyl(dimethyl)silyl]oxy-5-methoxyphenyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| SMILES | COc1ccc(O[Si](C)(C)C(C)(C)C)c(C/C(C)=C\CC/C(C)=C/CC/C(C)=C/CO)c1 |
| InChI | InChI=1S/C28H46O3Si/c1-22(12-10-14-23(2)18-19-29)13-11-15-24(3)20-25-21-26(30-7)16-17-27(25)31-32(8,9)28(4,5)6/h12,15-18,21,29H,10-11,13-14,19-20H2,1-9H3/b22-12+,23-18+,24-15- |
| InChIKey | LCPCHBWHQKHYTP-CMEQSONPSA-N |
| XLogP | 8.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|