C20H27BrO2Si — CID 140869039
[2-[(3-bromophenyl)methyl]-5-methoxyphenoxy]-tert-butyl-dimethylsilane (PubChem CID 140869039) has the molecular formula C20H27BrO2Si and a molecular weight of 407.42 g/mol. Its IUPAC name is [2-[(3-bromophenyl)methyl]-5-methoxyphenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-[(3-bromophenyl)methyl]-5-methoxyphenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140869039 |
| Molecular Formula | C20H27BrO2Si |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [2-[(3-bromophenyl)methyl]-5-methoxyphenoxy]-tert-butyl-dimethylsilane |
| SMILES | COc1ccc(Cc2cccc(Br)c2)c(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H27BrO2Si/c1-20(2,3)24(5,6)23-19-14-18(22-4)11-10-16(19)12-15-8-7-9-17(21)13-15/h7-11,13-14H,12H2,1-6H3 |
| InChIKey | ZDQSMRIPBURXKW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|