C25H38O5Si — CID 10917292
2-[(4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methyl-6-phenylmethoxyhexyl]pyran-4-one (PubChem CID 10917292) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is 2-[(4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methyl-6-phenylmethoxyhexyl]pyran-4-one.
| Compound Name | 2-[(4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methyl-6-phenylmethoxyhexyl]pyran-4-one |
|---|---|
| PubChem CID | 10917292 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-[(4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-methyl-6-phenylmethoxyhexyl]pyran-4-one |
| SMILES | C[C@@H](COCc1ccccc1)[C@H](O)CC(Cc1cc(=O)cco1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H38O5Si/c1-19(17-28-18-20-10-8-7-9-11-20)24(27)16-23(30-31(5,6)25(2,3)4)15-22-14-21(26)12-13-29-22/h7-14,19,23-24,27H,15-18H2,1-6H3/t19-,23?,24+/m0/s1 |
| InChIKey | ISNLSCKXFHZDLF-CRZGKLGHSA-N |
| XLogP | 5.18 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|