C34H58O4Si3 — CID 11520084
(2S)-1-phenylmethoxy-2,9-bis(triethylsilyloxy)-12-trimethylsilyldodeca-4,11-diyn-6-one (PubChem CID 11520084) has the molecular formula C34H58O4Si3 and a molecular weight of 615.09 g/mol. Its IUPAC name is (2S)-1-phenylmethoxy-2,9-bis(triethylsilyloxy)-12-trimethylsilyldodeca-4,11-diyn-6-one.
| Compound Name | (2S)-1-phenylmethoxy-2,9-bis(triethylsilyloxy)-12-trimethylsilyldodeca-4,11-diyn-6-one |
|---|---|
| PubChem CID | 11520084 |
| Molecular Formula | C34H58O4Si3 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | (2S)-1-phenylmethoxy-2,9-bis(triethylsilyloxy)-12-trimethylsilyldodeca-4,11-diyn-6-one |
| SMILES | CC[Si](CC)(CC)OC(CC#C[Si](C)(C)C)CCC(=O)C#CC[C@@H](COCc1ccccc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H58O4Si3/c1-10-40(11-2,12-3)37-33(25-20-28-39(7,8)9)27-26-32(35)23-19-24-34(38-41(13-4,14-5)15-6)30-36-29-31-21-17-16-18-22-31/h16-18,21-22,33-34H,10-15,24-27,29-30H2,1-9H3/t33?,34-/m0/s1 |
| InChIKey | KVWLHTICIJVBCM-DNKZHYAASA-N |
| XLogP | 9.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|