C24H37BrO5Si — CID 11684938
(2S)-1-[(4-bromophenyl)methoxy]-10,11-dihydroxy-2-triethylsilyloxyundec-4-yn-6-one (PubChem CID 11684938) has the molecular formula C24H37BrO5Si and a molecular weight of 513.55 g/mol. Its IUPAC name is (2S)-1-[(4-bromophenyl)methoxy]-10,11-dihydroxy-2-triethylsilyloxyundec-4-yn-6-one.
| Compound Name | (2S)-1-[(4-bromophenyl)methoxy]-10,11-dihydroxy-2-triethylsilyloxyundec-4-yn-6-one |
|---|---|
| PubChem CID | 11684938 |
| Molecular Formula | C24H37BrO5Si |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (2S)-1-[(4-bromophenyl)methoxy]-10,11-dihydroxy-2-triethylsilyloxyundec-4-yn-6-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC#CC(=O)CCCC(O)CO)COCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H37BrO5Si/c1-4-31(5-2,6-3)30-24(19-29-18-20-13-15-21(25)16-14-20)12-8-10-22(27)9-7-11-23(28)17-26/h13-16,23-24,26,28H,4-7,9,11-12,17-19H2,1-3H3/t23?,24-/m0/s1 |
| InChIKey | XVZMFFUSEIYWJW-CGAIIQECSA-N |
| XLogP | 4.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|