C24H38O5Si — CID 11633468
(2S,10S)-10,11-dihydroxy-1-phenylmethoxy-2-triethylsilyloxyundec-4-yn-6-one (PubChem CID 11633468) has the molecular formula C24H38O5Si and a molecular weight of 434.65 g/mol. Its IUPAC name is (2S,10S)-10,11-dihydroxy-1-phenylmethoxy-2-triethylsilyloxyundec-4-yn-6-one.
| Compound Name | (2S,10S)-10,11-dihydroxy-1-phenylmethoxy-2-triethylsilyloxyundec-4-yn-6-one |
|---|---|
| PubChem CID | 11633468 |
| Molecular Formula | C24H38O5Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (2S,10S)-10,11-dihydroxy-1-phenylmethoxy-2-triethylsilyloxyundec-4-yn-6-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC#CC(=O)CCC[C@H](O)CO)COCc1ccccc1 |
| InChI | InChI=1S/C24H38O5Si/c1-4-30(5-2,6-3)29-24(20-28-19-21-12-8-7-9-13-21)17-11-15-22(26)14-10-16-23(27)18-25/h7-9,12-13,23-25,27H,4-6,10,14,16-20H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | SBZWQFDKVSIVIT-ZEQRLZLVSA-N |
| XLogP | 4.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|