C16H21CrNSi — CID 11730019
[(E)-3-phenyl-1-(4-trimethylsilylbut-3-ynylamino)prop-2-enylidene]chromium (PubChem CID 11730019) has the molecular formula C16H21CrNSi and a molecular weight of 307.43 g/mol. Its IUPAC name is [(E)-3-phenyl-1-(4-trimethylsilylbut-3-ynylamino)prop-2-enylidene]chromium.
| Compound Name | [(E)-3-phenyl-1-(4-trimethylsilylbut-3-ynylamino)prop-2-enylidene]chromium |
|---|---|
| PubChem CID | 11730019 |
| Molecular Formula | C16H21CrNSi |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | [(E)-3-phenyl-1-(4-trimethylsilylbut-3-ynylamino)prop-2-enylidene]chromium |
| SMILES | C[Si](C)(C)C#CCCNC(=[Cr])/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H21NSi.Cr/c1-18(2,3)15-8-7-13-17-14-9-12-16-10-5-4-6-11-16;/h4-6,9-12,17H,7,13H2,1-3H3;/b12-9+; |
| InChIKey | FHKLZTHZZNPAOL-NBYYMMLRSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|