C22H26Si — CID 102080744
tert-butyl-[(E)-3,4-diphenylbut-3-en-1-ynyl]-dimethylsilane (PubChem CID 102080744) has the molecular formula C22H26Si and a molecular weight of 318.54 g/mol. Its IUPAC name is tert-butyl-[(E)-3,4-diphenylbut-3-en-1-ynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3,4-diphenylbut-3-en-1-ynyl]-dimethylsilane |
|---|---|
| PubChem CID | 102080744 |
| Molecular Formula | C22H26Si |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | tert-butyl-[(E)-3,4-diphenylbut-3-en-1-ynyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C#C/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26Si/c1-22(2,3)23(4,5)17-16-21(20-14-10-7-11-15-20)18-19-12-8-6-9-13-19/h6-15,18H,1-5H3/b21-18- |
| InChIKey | BANUHLKPSHGTPH-UZYVYHOESA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|