C20H28OSi — CID 134940588
(1E)-3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1-phenylhexa-1,4-dien-3-ol (PubChem CID 134940588) has the molecular formula C20H28OSi and a molecular weight of 312.53 g/mol. Its IUPAC name is (1E)-3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1-phenylhexa-1,4-dien-3-ol.
| Compound Name | (1E)-3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1-phenylhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 134940588 |
| Molecular Formula | C20H28OSi |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (1E)-3-[2-[tert-butyl(dimethyl)silyl]ethynyl]-1-phenylhexa-1,4-dien-3-ol |
| SMILES | CC=CC(O)(C#C[Si](C)(C)C(C)(C)C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H28OSi/c1-7-14-20(21,15-13-18-11-9-8-10-12-18)16-17-22(5,6)19(2,3)4/h7-15,21H,1-6H3/b14-7?,15-13+ |
| InChIKey | PYXXNJPSTCVPCM-JGKVQJRUSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|