C29H32OSi — CID 16756347
(2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]-1,1-diphenylbut-3-yn-1-ol (PubChem CID 16756347) has the molecular formula C29H32OSi and a molecular weight of 424.66 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]-1,1-diphenylbut-3-yn-1-ol.
| Compound Name | (2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]-1,1-diphenylbut-3-yn-1-ol |
|---|---|
| PubChem CID | 16756347 |
| Molecular Formula | C29H32OSi |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]-1,1-diphenylbut-3-yn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)C#C/C(=C/c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32OSi/c1-28(2,3)31(4,5)22-21-27(23-24-15-9-6-10-16-24)29(30,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,30H,1-5H3/b27-23- |
| InChIKey | HCVDLJRAMIBRGO-VYIQYICTSA-N |
| XLogP | 7.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|