C20H36S2Si2 — CID 10810782
tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]-3,4-bis(methylsulfanyl)hex-3-en-1,5-diynyl]-dimethylsilane (PubChem CID 10810782) has the molecular formula C20H36S2Si2 and a molecular weight of 396.81 g/mol. Its IUPAC name is tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]-3,4-bis(methylsulfanyl)hex-3-en-1,5-diynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]-3,4-bis(methylsulfanyl)hex-3-en-1,5-diynyl]-dimethylsilane |
|---|---|
| PubChem CID | 10810782 |
| Molecular Formula | C20H36S2Si2 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tert-butyl-[(E)-6-[tert-butyl(dimethyl)silyl]-3,4-bis(methylsulfanyl)hex-3-en-1,5-diynyl]-dimethylsilane |
| SMILES | CS/C(C#C[Si](C)(C)C(C)(C)C)=C(\C#C[Si](C)(C)C(C)(C)C)SC |
| InChI | InChI=1S/C20H36S2Si2/c1-19(2,3)23(9,10)15-13-17(21-7)18(22-8)14-16-24(11,12)20(4,5)6/h1-12H3/b18-17+ |
| InChIKey | GABXUDBEEBFOKA-ISLYRVAYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|