C18H26OSi — CID 102296200
tert-butyl-[(Z)-3-(methoxymethyl)-4-phenylbut-3-en-1-ynyl]-dimethylsilane (PubChem CID 102296200) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is tert-butyl-[(Z)-3-(methoxymethyl)-4-phenylbut-3-en-1-ynyl]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-3-(methoxymethyl)-4-phenylbut-3-en-1-ynyl]-dimethylsilane |
|---|---|
| PubChem CID | 102296200 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl-[(Z)-3-(methoxymethyl)-4-phenylbut-3-en-1-ynyl]-dimethylsilane |
| SMILES | COC/C(C#C[Si](C)(C)C(C)(C)C)=C\c1ccccc1 |
| InChI | InChI=1S/C18H26OSi/c1-18(2,3)20(5,6)13-12-17(15-19-4)14-16-10-8-7-9-11-16/h7-11,14H,15H2,1-6H3/b17-14- |
| InChIKey | CRNNMQBAIGNKGE-VKAVYKQESA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|