C24H29NOSi — CID 101468566
N-[(2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]but-3-ynyl]benzamide (PubChem CID 101468566) has the molecular formula C24H29NOSi and a molecular weight of 375.59 g/mol. Its IUPAC name is N-[(2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]but-3-ynyl]benzamide.
| Compound Name | N-[(2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]but-3-ynyl]benzamide |
|---|---|
| PubChem CID | 101468566 |
| Molecular Formula | C24H29NOSi |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(2Z)-2-benzylidene-4-[tert-butyl(dimethyl)silyl]but-3-ynyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)C#C/C(=C/c1ccccc1)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29NOSi/c1-24(2,3)27(4,5)17-16-21(18-20-12-8-6-9-13-20)19-25-23(26)22-14-10-7-11-15-22/h6-15,18H,19H2,1-5H3,(H,25,26)/b21-18- |
| InChIKey | MDRFOCSGGIWJAV-UZYVYHOESA-N |
| XLogP | 5.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|