C16H20Si — CID 11447833
tert-butyl-[2-(4-ethynylphenyl)ethynyl]-dimethylsilane (PubChem CID 11447833) has the molecular formula C16H20Si and a molecular weight of 240.42 g/mol. Its IUPAC name is tert-butyl-[2-(4-ethynylphenyl)ethynyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-(4-ethynylphenyl)ethynyl]-dimethylsilane |
|---|---|
| PubChem CID | 11447833 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | tert-butyl-[2-(4-ethynylphenyl)ethynyl]-dimethylsilane |
| SMILES | C#Cc1ccc(C#C[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H20Si/c1-7-14-8-10-15(11-9-14)12-13-17(5,6)16(2,3)4/h1,8-11H,2-6H3 |
| InChIKey | MTGBBOSYTRBKON-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|