C37H49IO9Si — CID 158993539
2-[(4-ethynylphenyl)methoxy]propane-1,3-diol;2-[(4-iodophenyl)methoxy]propane-1,3-diol;2-[[4-(2-trimethylsilylethynyl)phenyl]methoxy]propane-1,3-diol (PubChem CID 158993539) has the molecular formula C37H49IO9Si and a molecular weight of 792.78 g/mol. Its IUPAC name is 2-[(4-ethynylphenyl)methoxy]propane-1,3-diol;2-[(4-iodophenyl)methoxy]propane-1,3-diol;2-[[4-(2-trimethylsilylethynyl)phenyl]methoxy]propane-1,3-diol.
| Compound Name | 2-[(4-ethynylphenyl)methoxy]propane-1,3-diol;2-[(4-iodophenyl)methoxy]propane-1,3-diol;2-[[4-(2-trimethylsilylethynyl)phenyl]methoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 158993539 |
| Molecular Formula | C37H49IO9Si |
| Molecular Weight | 792.78 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 2-[(4-ethynylphenyl)methoxy]propane-1,3-diol;2-[(4-iodophenyl)methoxy]propane-1,3-diol;2-[[4-(2-trimethylsilylethynyl)phenyl]methoxy]propane-1,3-diol |
| SMILES | C#Cc1ccc(COC(CO)CO)cc1.C[Si](C)(C)C#Cc1ccc(COC(CO)CO)cc1.OCC(CO)OCc1ccc(I)cc1 |
| InChI | InChI=1S/C15H22O3Si.C12H14O3.C10H13IO3/c1-19(2,3)9-8-13-4-6-14(7-5-13)12-18-15(10-16)11-17;1-2-10-3-5-11(6-4-10)9-15-12(7-13)8-14;11-9-3-1-8(2-4-9)7-14-10(5-12)6-13/h4-7,15-17H,10-12H2,1-3H3;1,3-6,12-14H,7-9H2;1-4,10,12-13H,5-7H2 |
| InChIKey | JQLOBBTZFWJICZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|