C18H28ClNO2Si — CID 178001737
methyl (3S)-3-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]ethynyl]phenyl]propanoate;hydrochloride (PubChem CID 178001737) has the molecular formula C18H28ClNO2Si and a molecular weight of 353.97 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]ethynyl]phenyl]propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]ethynyl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 178001737 |
| Molecular Formula | C18H28ClNO2Si |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl (3S)-3-amino-3-[4-[2-[tert-butyl(dimethyl)silyl]ethynyl]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1ccc(C#C[Si](C)(C)C(C)(C)C)cc1.Cl |
| InChI | InChI=1S/C18H27NO2Si.ClH/c1-18(2,3)22(5,6)12-11-14-7-9-15(10-8-14)16(19)13-17(20)21-4;/h7-10,16H,13,19H2,1-6H3;1H/t16-;/m0./s1 |
| InChIKey | SQVXDYVZOPIESG-NTISSMGPSA-N |
| XLogP | 4.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|