C20H27FOSi — CID 175187393
1-(2-fluorophenyl)-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol (PubChem CID 175187393) has the molecular formula C20H27FOSi and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol.
| Compound Name | 1-(2-fluorophenyl)-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol |
|---|---|
| PubChem CID | 175187393 |
| Molecular Formula | C20H27FOSi |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-(2-fluorophenyl)-5-tri(propan-2-yl)silylpenta-2,4-diyn-1-ol |
| SMILES | CC(C)[Si](C#CC#CC(O)c1ccccc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H27FOSi/c1-15(2)23(16(3)4,17(5)6)14-10-9-13-20(22)18-11-7-8-12-19(18)21/h7-8,11-12,15-17,20,22H,1-6H3 |
| InChIKey | CVBCULBMOIERDS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|