C22H34Si — CID 175036788
6-phenylhept-6-en-1-ynyl-tri(propan-2-yl)silane (PubChem CID 175036788) has the molecular formula C22H34Si and a molecular weight of 326.60 g/mol. Its IUPAC name is 6-phenylhept-6-en-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 6-phenylhept-6-en-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 175036788 |
| Molecular Formula | C22H34Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 6-phenylhept-6-en-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=C(CCCC#C[Si](C(C)C)(C(C)C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H34Si/c1-18(2)23(19(3)4,20(5)6)17-13-9-10-14-21(7)22-15-11-8-12-16-22/h8,11-12,15-16,18-20H,7,9-10,14H2,1-6H3 |
| InChIKey | KMCOBUQDYZCSAI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|