C16H20 — CID 10680066
7,7-dimethyloct-1-en-5-yn-2-ylbenzene (PubChem CID 10680066) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 7,7-dimethyloct-1-en-5-yn-2-ylbenzene.
| Compound Name | 7,7-dimethyloct-1-en-5-yn-2-ylbenzene |
|---|---|
| PubChem CID | 10680066 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 7,7-dimethyloct-1-en-5-yn-2-ylbenzene |
| SMILES | C=C(CCC#CC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H20/c1-14(15-11-6-5-7-12-15)10-8-9-13-16(2,3)4/h5-7,11-12H,1,8,10H2,2-4H3 |
| InChIKey | YUPBLFPFCCROEU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|