C16H21N — CID 175496136
5,5-dimethyl-7-phenyloct-7-enenitrile (PubChem CID 175496136) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 5,5-dimethyl-7-phenyloct-7-enenitrile.
| Compound Name | 5,5-dimethyl-7-phenyloct-7-enenitrile |
|---|---|
| PubChem CID | 175496136 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 5,5-dimethyl-7-phenyloct-7-enenitrile |
| SMILES | C=C(CC(C)(C)CCCC#N)c1ccccc1 |
| InChI | InChI=1S/C16H21N/c1-14(15-9-5-4-6-10-15)13-16(2,3)11-7-8-12-17/h4-6,9-10H,1,7-8,11,13H2,2-3H3 |
| InChIKey | FSEXOSWYLDYKIN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|