C22H24O — CID 102480469
3-methyl-1,3-diphenylnon-4-yn-1-one (PubChem CID 102480469) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-methyl-1,3-diphenylnon-4-yn-1-one.
| Compound Name | 3-methyl-1,3-diphenylnon-4-yn-1-one |
|---|---|
| PubChem CID | 102480469 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-methyl-1,3-diphenylnon-4-yn-1-one |
| SMILES | CCCCC#CC(C)(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24O/c1-3-4-5-12-17-22(2,20-15-10-7-11-16-20)18-21(23)19-13-8-6-9-14-19/h6-11,13-16H,3-5,18H2,1-2H3 |
| InChIKey | WWCKLTJVGADPAH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|