About 5-phenylundec-6-yn-5-ol
5-phenylundec-6-yn-5-ol (PubChem CID 172639655) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-phenylundec-6-yn-5-ol.
Molecular Properties
| Compound Name | 5-phenylundec-6-yn-5-ol |
| PubChem CID | 172639655 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 5-phenylundec-6-yn-5-ol |
| SMILES | CCCCC#CC(O)(CCCC)c1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-3-5-7-11-15-17(18,14-6-4-2)16-12-9-8-10-13-16/h8-10,12-13,18H,3-7,14H2,1-2H3 |
| InChIKey | ZVCXQWCQSGCWDK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylundec-6-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylundec-6-yn-5-ol?
The IUPAC name of 5-phenylundec-6-yn-5-ol (CID 172639655) is 5-phenylundec-6-yn-5-ol.
What is the SMILES notation for 5-phenylundec-6-yn-5-ol?
The canonical SMILES for 5-phenylundec-6-yn-5-ol is CCCCC#CC(O)(CCCC)c1ccccc1.
What is the InChIKey of 5-phenylundec-6-yn-5-ol?
The InChIKey is ZVCXQWCQSGCWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-3-5-7-11-15-17(18,14-6-4-2)16-12-9-8-10-13-16/h8-10,12-13,18H,3-7,14H2,1-2H3.
What are the key properties of 5-phenylundec-6-yn-5-ol?
5-phenylundec-6-yn-5-ol has a molecular weight of 244.38 g/mol, XLogP of 4.26, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylundec-6-yn-5-ol is sourced from PubChem (CID 172639655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).