C16H26O2 — CID 102249526
7,8-dimethyltetradeca-5,9-diyne-7,8-diol (PubChem CID 102249526) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 7,8-dimethyltetradeca-5,9-diyne-7,8-diol.
| Compound Name | 7,8-dimethyltetradeca-5,9-diyne-7,8-diol |
|---|---|
| PubChem CID | 102249526 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 7,8-dimethyltetradeca-5,9-diyne-7,8-diol |
| SMILES | CCCCC#CC(C)(O)C(C)(O)C#CCCCC |
| InChI | InChI=1S/C16H26O2/c1-5-7-9-11-13-15(3,17)16(4,18)14-12-10-8-6-2/h17-18H,5-10H2,1-4H3 |
| InChIKey | HAIDUQCSYMRSJL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|