C15H22FNO2 — CID 158274515
4-(4-fluorophenyl)oct-2-yne-1,4-diol;methanamine (PubChem CID 158274515) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)oct-2-yne-1,4-diol;methanamine.
| Compound Name | 4-(4-fluorophenyl)oct-2-yne-1,4-diol;methanamine |
|---|---|
| PubChem CID | 158274515 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-(4-fluorophenyl)oct-2-yne-1,4-diol;methanamine |
| SMILES | CCCCC(O)(C#CCO)c1ccc(F)cc1.CN |
| InChI | InChI=1S/C14H17FO2.CH5N/c1-2-3-9-14(17,10-4-11-16)12-5-7-13(15)8-6-12;1-2/h5-8,16-17H,2-3,9,11H2,1H3;2H2,1H3 |
| InChIKey | GJLFAWMXWAJSPT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|