C16H30O2 — CID 92529620
(5S,8R)-5,8-diethyldodec-6-yne-5,8-diol (PubChem CID 92529620) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (5S,8R)-5,8-diethyldodec-6-yne-5,8-diol.
| Compound Name | (5S,8R)-5,8-diethyldodec-6-yne-5,8-diol |
|---|---|
| PubChem CID | 92529620 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (5S,8R)-5,8-diethyldodec-6-yne-5,8-diol |
| SMILES | CCCC[C@@](O)(C#C[C@](O)(CC)CCCC)CC |
| InChI | InChI=1S/C16H30O2/c1-5-9-11-15(17,7-3)13-14-16(18,8-4)12-10-6-2/h17-18H,5-12H2,1-4H3/t15-,16+ |
| InChIKey | QXKKYGUIDYNRJP-IYBDPMFKSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|