C11H13F3OS — CID 150861897
1-(1,1-difluoropentylsulfinyl)-4-fluorobenzene (PubChem CID 150861897) has the molecular formula C11H13F3OS and a molecular weight of 250.28 g/mol. Its IUPAC name is 1-(1,1-difluoropentylsulfinyl)-4-fluorobenzene.
| Compound Name | 1-(1,1-difluoropentylsulfinyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 150861897 |
| Molecular Formula | C11H13F3OS |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-(1,1-difluoropentylsulfinyl)-4-fluorobenzene |
| SMILES | CCCCC(F)(F)S(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13F3OS/c1-2-3-8-11(13,14)16(15)10-6-4-9(12)5-7-10/h4-7H,2-3,8H2,1H3 |
| InChIKey | KSFBDMWYKVTPRT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |