C13H18FNO2S — CID 63793163
N,N-diethyl-2-(4-fluorophenyl)sulfinylpropanamide (PubChem CID 63793163) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is N,N-diethyl-2-(4-fluorophenyl)sulfinylpropanamide.
| Compound Name | N,N-diethyl-2-(4-fluorophenyl)sulfinylpropanamide |
|---|---|
| PubChem CID | 63793163 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N,N-diethyl-2-(4-fluorophenyl)sulfinylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)S(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO2S/c1-4-15(5-2)13(16)10(3)18(17)12-8-6-11(14)7-9-12/h6-10H,4-5H2,1-3H3 |
| InChIKey | CANCWMLFRVAOAV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |