About N-hept-2-ynylbenzamide
N-hept-2-ynylbenzamide (PubChem CID 102291976) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-hept-2-ynylbenzamide.
Molecular Properties
| Compound Name | N-hept-2-ynylbenzamide |
| PubChem CID | 102291976 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-hept-2-ynylbenzamide |
| SMILES | CCCCC#CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-4-5-9-12-15-14(16)13-10-7-6-8-11-13/h6-8,10-11H,2-4,12H2,1H3,(H,15,16) |
| InChIKey | KINPWVQGGSPIJE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hept-2-ynylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hept-2-ynylbenzamide?
The IUPAC name of N-hept-2-ynylbenzamide (CID 102291976) is N-hept-2-ynylbenzamide.
What is the SMILES notation for N-hept-2-ynylbenzamide?
The canonical SMILES for N-hept-2-ynylbenzamide is CCCCC#CCNC(=O)c1ccccc1.
What is the InChIKey of N-hept-2-ynylbenzamide?
The InChIKey is KINPWVQGGSPIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-2-3-4-5-9-12-15-14(16)13-10-7-6-8-11-13/h6-8,10-11H,2-4,12H2,1H3,(H,15,16).
What are the key properties of N-hept-2-ynylbenzamide?
N-hept-2-ynylbenzamide has a molecular weight of 215.30 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hept-2-ynylbenzamide is sourced from PubChem (CID 102291976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).