C17H12F3NO — CID 102346250
(2S)-4-oxo-2,4-diphenyl-2-(trifluoromethyl)butanenitrile (PubChem CID 102346250) has the molecular formula C17H12F3NO and a molecular weight of 303.28 g/mol. Its IUPAC name is (2S)-4-oxo-2,4-diphenyl-2-(trifluoromethyl)butanenitrile.
| Compound Name | (2S)-4-oxo-2,4-diphenyl-2-(trifluoromethyl)butanenitrile |
|---|---|
| PubChem CID | 102346250 |
| Molecular Formula | C17H12F3NO |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2S)-4-oxo-2,4-diphenyl-2-(trifluoromethyl)butanenitrile |
| SMILES | N#C[C@](CC(=O)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H12F3NO/c18-17(19,20)16(12-21,14-9-5-2-6-10-14)11-15(22)13-7-3-1-4-8-13/h1-10H,11H2/t16-/m1/s1 |
| InChIKey | VBTGFGNPNCDWEO-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |