C13H11NO7 — CID 150780403
2-cyano-2,3-dihydroxy-3-phenacylbutanedioic acid (PubChem CID 150780403) has the molecular formula C13H11NO7 and a molecular weight of 293.23 g/mol. Its IUPAC name is 2-cyano-2,3-dihydroxy-3-phenacylbutanedioic acid.
| Compound Name | 2-cyano-2,3-dihydroxy-3-phenacylbutanedioic acid |
|---|---|
| PubChem CID | 150780403 |
| Molecular Formula | C13H11NO7 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-cyano-2,3-dihydroxy-3-phenacylbutanedioic acid |
| SMILES | N#CC(O)(C(=O)O)C(O)(CC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H11NO7/c14-7-13(21,11(18)19)12(20,10(16)17)6-9(15)8-4-2-1-3-5-8/h1-5,20-21H,6H2,(H,16,17)(H,18,19) |
| InChIKey | KBTAWPBPTLFJPM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|