C12H11BrO7 — CID 150599938
2-bromo-2,3-dihydroxy-3-phenacylbutanedioic acid (PubChem CID 150599938) has the molecular formula C12H11BrO7 and a molecular weight of 347.12 g/mol. Its IUPAC name is 2-bromo-2,3-dihydroxy-3-phenacylbutanedioic acid.
| Compound Name | 2-bromo-2,3-dihydroxy-3-phenacylbutanedioic acid |
|---|---|
| PubChem CID | 150599938 |
| Molecular Formula | C12H11BrO7 |
| Molecular Weight | 347.12 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 2-bromo-2,3-dihydroxy-3-phenacylbutanedioic acid |
| SMILES | O=C(CC(O)(C(=O)O)C(O)(Br)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H11BrO7/c13-12(20,10(17)18)11(19,9(15)16)6-8(14)7-4-2-1-3-5-7/h1-5,19-20H,6H2,(H,15,16)(H,17,18) |
| InChIKey | IRQRHESSAOXZBG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|