C21H31ClSi — CID 102235448
[4-(4-chlorophenyl)-3-methylidenepent-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 102235448) has the molecular formula C21H31ClSi and a molecular weight of 347.02 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-3-methylidenepent-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [4-(4-chlorophenyl)-3-methylidenepent-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102235448 |
| Molecular Formula | C21H31ClSi |
| Molecular Weight | 347.02 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | [4-(4-chlorophenyl)-3-methylidenepent-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H31ClSi/c1-15(2)23(16(3)4,17(5)6)14-13-18(7)19(8)20-9-11-21(22)12-10-20/h9-12,15-17,19H,7H2,1-6,8H3 |
| InChIKey | AGNMIYXSGAGZNK-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.02 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|