C21H34ClNO2Si — CID 154049382
(1R,2S)-1-(4-chlorophenyl)-1-(methoxymethoxy)-4-tri(propan-2-yl)silylbut-3-yn-2-amine (PubChem CID 154049382) has the molecular formula C21H34ClNO2Si and a molecular weight of 396.05 g/mol. Its IUPAC name is (1R,2S)-1-(4-chlorophenyl)-1-(methoxymethoxy)-4-tri(propan-2-yl)silylbut-3-yn-2-amine.
| Compound Name | (1R,2S)-1-(4-chlorophenyl)-1-(methoxymethoxy)-4-tri(propan-2-yl)silylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 154049382 |
| Molecular Formula | C21H34ClNO2Si |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | (1R,2S)-1-(4-chlorophenyl)-1-(methoxymethoxy)-4-tri(propan-2-yl)silylbut-3-yn-2-amine |
| SMILES | COCO[C@H](c1ccc(Cl)cc1)[C@@H](N)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H34ClNO2Si/c1-15(2)26(16(3)4,17(5)6)13-12-20(23)21(25-14-24-7)18-8-10-19(22)11-9-18/h8-11,15-17,20-21H,14,23H2,1-7H3/t20-,21+/m0/s1 |
| InChIKey | ZFRTXBQLJWXNQC-LEWJYISDSA-N |
| XLogP | 5.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|