C21H31Cl2NO2Si — CID 154137130
2-chloro-N-[(1R,2S)-1-(4-chlorophenyl)-1-hydroxy-4-tri(propan-2-yl)silylbut-3-yn-2-yl]acetamide (PubChem CID 154137130) has the molecular formula C21H31Cl2NO2Si and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-1-(4-chlorophenyl)-1-hydroxy-4-tri(propan-2-yl)silylbut-3-yn-2-yl]acetamide.
| Compound Name | 2-chloro-N-[(1R,2S)-1-(4-chlorophenyl)-1-hydroxy-4-tri(propan-2-yl)silylbut-3-yn-2-yl]acetamide |
|---|---|
| PubChem CID | 154137130 |
| Molecular Formula | C21H31Cl2NO2Si |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-1-(4-chlorophenyl)-1-hydroxy-4-tri(propan-2-yl)silylbut-3-yn-2-yl]acetamide |
| SMILES | CC(C)[Si](C#C[C@H](NC(=O)CCl)[C@H](O)c1ccc(Cl)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H31Cl2NO2Si/c1-14(2)27(15(3)4,16(5)6)12-11-19(24-20(25)13-22)21(26)17-7-9-18(23)10-8-17/h7-10,14-16,19,21,26H,13H2,1-6H3,(H,24,25)/t19-,21+/m0/s1 |
| InChIKey | XQGXVAAZXOXPNK-PZJWPPBQSA-N |
| XLogP | 5.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|