C18H12Cl2 — CID 101383793
1-chloro-4-[(3S,4S)-4-(4-chlorophenyl)hexa-1,5-diyn-3-yl]benzene (PubChem CID 101383793) has the molecular formula C18H12Cl2 and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-chloro-4-[(3S,4S)-4-(4-chlorophenyl)hexa-1,5-diyn-3-yl]benzene.
| Compound Name | 1-chloro-4-[(3S,4S)-4-(4-chlorophenyl)hexa-1,5-diyn-3-yl]benzene |
|---|---|
| PubChem CID | 101383793 |
| Molecular Formula | C18H12Cl2 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-chloro-4-[(3S,4S)-4-(4-chlorophenyl)hexa-1,5-diyn-3-yl]benzene |
| SMILES | C#C[C@@H](c1ccc(Cl)cc1)[C@@H](C#C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h1-2,5-12,17-18H/t17-,18-/m0/s1 |
| InChIKey | BLKSUHFNQBLTKD-ROUUACIJSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|