C16H15ClN2 — CID 22996221
1-(4-chlorophenyl)-2-(4-ethynylphenyl)ethane-1,2-diamine (PubChem CID 22996221) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(4-ethynylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(4-chlorophenyl)-2-(4-ethynylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22996221 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(4-ethynylphenyl)ethane-1,2-diamine |
| SMILES | C#Cc1ccc(C(N)C(N)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H15ClN2/c1-2-11-3-5-12(6-4-11)15(18)16(19)13-7-9-14(17)10-8-13/h1,3-10,15-16H,18-19H2 |
| InChIKey | FOHNTIGIDOHYMD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|