C12H19ClN2 — CID 69494037
1-(4-chlorophenyl)-3,3-dimethylbutane-1,2-diamine (PubChem CID 69494037) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,3-dimethylbutane-1,2-diamine.
| Compound Name | 1-(4-chlorophenyl)-3,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 69494037 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)(C)C(N)C(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H19ClN2/c1-12(2,3)11(15)10(14)8-4-6-9(13)7-5-8/h4-7,10-11H,14-15H2,1-3H3 |
| InChIKey | JSMUNFOEFROMBD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |