C12H22Cl2N2 — CID 53487564
(1R,2R)-3,3-dimethyl-1-phenylbutane-1,2-diamine;dihydrochloride (PubChem CID 53487564) has the molecular formula C12H22Cl2N2 and a molecular weight of 265.23 g/mol. Its IUPAC name is (1R,2R)-3,3-dimethyl-1-phenylbutane-1,2-diamine;dihydrochloride.
| Compound Name | (1R,2R)-3,3-dimethyl-1-phenylbutane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 53487564 |
| Molecular Formula | C12H22Cl2N2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1R,2R)-3,3-dimethyl-1-phenylbutane-1,2-diamine;dihydrochloride |
| SMILES | CC(C)(C)[C@@H](N)[C@H](N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C12H20N2.2ClH/c1-12(2,3)11(14)10(13)9-7-5-4-6-8-9;;/h4-8,10-11H,13-14H2,1-3H3;2*1H/t10-,11+;;/m1../s1 |
| InChIKey | FVSWXBHZFPVIKQ-OXPNAJOUSA-N |
| XLogP | 2.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |