C15H16Cl2N2 — CID 67126047
(1S,2R)-1,2-bis(4-chlorophenyl)-N'-methylethane-1,2-diamine (PubChem CID 67126047) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is (1S,2R)-1,2-bis(4-chlorophenyl)-N'-methylethane-1,2-diamine.
| Compound Name | (1S,2R)-1,2-bis(4-chlorophenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 67126047 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (1S,2R)-1,2-bis(4-chlorophenyl)-N'-methylethane-1,2-diamine |
| SMILES | CN[C@H](c1ccc(Cl)cc1)[C@@H](N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16Cl2N2/c1-19-15(11-4-8-13(17)9-5-11)14(18)10-2-6-12(16)7-3-10/h2-9,14-15,19H,18H2,1H3/t14-,15+/m0/s1 |
| InChIKey | HHCMXXSDBKXUBS-LSDHHAIUSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |