C12H18ClNO2 — CID 162516854
(1S)-1-(4-chlorophenyl)-2,2-diethoxyethanamine (PubChem CID 162516854) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is (1S)-1-(4-chlorophenyl)-2,2-diethoxyethanamine.
| Compound Name | (1S)-1-(4-chlorophenyl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 162516854 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1S)-1-(4-chlorophenyl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)[C@@H](N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO2/c1-3-15-12(16-4-2)11(14)9-5-7-10(13)8-6-9/h5-8,11-12H,3-4,14H2,1-2H3/t11-/m0/s1 |
| InChIKey | SIACVJHEWGSFJA-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|