C13H20ClNO3 — CID 79495966
1-(5-chloro-2-methoxyphenyl)-2,2-diethoxyethanamine (PubChem CID 79495966) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-2,2-diethoxyethanamine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 79495966 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)C(N)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H20ClNO3/c1-4-17-13(18-5-2)12(15)10-8-9(14)6-7-11(10)16-3/h6-8,12-13H,4-5,15H2,1-3H3 |
| InChIKey | NBCIFNPKACSEKY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|