C14H18ClNO3 — CID 114729832
1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethanamine (PubChem CID 114729832) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethanamine.
| Compound Name | 1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 114729832 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethanamine |
| SMILES | CCOC(OCC)C(N)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H18ClNO3/c1-3-17-14(18-4-2)13(16)12-8-9-7-10(15)5-6-11(9)19-12/h5-8,13-14H,3-4,16H2,1-2H3 |
| InChIKey | XNIQSDHJCDHABO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|