C14H19ClN2O3 — CID 105246260
[1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethyl]hydrazine (PubChem CID 105246260) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is [1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethyl]hydrazine.
| Compound Name | [1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105246260 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [1-(5-chloro-1-benzofuran-2-yl)-2,2-diethoxyethyl]hydrazine |
| SMILES | CCOC(OCC)C(NN)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-3-18-14(19-4-2)13(17-16)12-8-9-7-10(15)5-6-11(9)20-12/h5-8,13-14,17H,3-4,16H2,1-2H3 |
| InChIKey | KGJYVSQWWPFRDK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|