C11H15ClO — CID 58172166
(1S)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-ol (PubChem CID 58172166) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is (1S)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | (1S)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 58172166 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (1S)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClO/c1-11(2,3)10(13)8-4-6-9(12)7-5-8/h4-7,10,13H,1-3H3/t10-/m1/s1 |
| InChIKey | KVQHMAMNJSQJBE-SNVBAGLBSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |