C22H30Cl2N2 — CID 13095453
1,2-bis[1-(4-chlorophenyl)-2,2-dimethylpropyl]hydrazine (PubChem CID 13095453) has the molecular formula C22H30Cl2N2 and a molecular weight of 393.40 g/mol. Its IUPAC name is 1,2-bis[1-(4-chlorophenyl)-2,2-dimethylpropyl]hydrazine.
| Compound Name | 1,2-bis[1-(4-chlorophenyl)-2,2-dimethylpropyl]hydrazine |
|---|---|
| PubChem CID | 13095453 |
| Molecular Formula | C22H30Cl2N2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1,2-bis[1-(4-chlorophenyl)-2,2-dimethylpropyl]hydrazine |
| SMILES | CC(C)(C)C(NNC(c1ccc(Cl)cc1)C(C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30Cl2N2/c1-21(2,3)19(15-7-11-17(23)12-8-15)25-26-20(22(4,5)6)16-9-13-18(24)14-10-16/h7-14,19-20,25-26H,1-6H3 |
| InChIKey | FONGJNSFKUCRGW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|