C40H54N2O2SSi2 — CID 15441211
N,N-dimethyl-4-[3-[2-(5-nitrothiophen-2-yl)ethynyl]-6-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]aniline (PubChem CID 15441211) has the molecular formula C40H54N2O2SSi2 and a molecular weight of 683.12 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[2-(5-nitrothiophen-2-yl)ethynyl]-6-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]aniline.
| Compound Name | N,N-dimethyl-4-[3-[2-(5-nitrothiophen-2-yl)ethynyl]-6-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]aniline |
|---|---|
| PubChem CID | 15441211 |
| Molecular Formula | C40H54N2O2SSi2 |
| Molecular Weight | 683.12 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | N,N-dimethyl-4-[3-[2-(5-nitrothiophen-2-yl)ethynyl]-6-tri(propan-2-yl)silyl-4-[2-tri(propan-2-yl)silylethynyl]hex-3-en-1,5-diynyl]aniline |
| SMILES | CC(C)[Si](C#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(C#Cc1ccc(N(C)C)cc1)C#Cc1ccc([N+](=O)[O-])s1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H54N2O2SSi2/c1-29(2)46(30(3)4,31(5)6)27-25-37(26-28-47(32(7)8,33(9)10)34(11)12)36(19-22-39-23-24-40(45-39)42(43)44)18-15-35-16-20-38(21-17-35)41(13)14/h16-17,20-21,23-24,29-34H,1-14H3 |
| InChIKey | DSRQNLVNRDUAFK-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.12 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|