C29H13NO3S5 — CID 11599578
2-[2-[5-[2-(5-methoxythiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]-5-[2-[5-[2-(5-nitrothiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]thiophene (PubChem CID 11599578) has the molecular formula C29H13NO3S5 and a molecular weight of 583.76 g/mol. Its IUPAC name is 2-[2-[5-[2-(5-methoxythiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]-5-[2-[5-[2-(5-nitrothiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]thiophene.
| Compound Name | 2-[2-[5-[2-(5-methoxythiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]-5-[2-[5-[2-(5-nitrothiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]thiophene |
|---|---|
| PubChem CID | 11599578 |
| Molecular Formula | C29H13NO3S5 |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 582.95 |
| IUPAC Name | 2-[2-[5-[2-(5-methoxythiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]-5-[2-[5-[2-(5-nitrothiophen-2-yl)ethynyl]thiophen-2-yl]ethynyl]thiophene |
| SMILES | COc1ccc(C#Cc2ccc(C#Cc3ccc(C#Cc4ccc(C#Cc5ccc([N+](=O)[O-])s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C29H13NO3S5/c1-33-29-19-17-27(38-29)15-13-25-11-9-23(36-25)7-5-21-3-2-20(34-21)4-6-22-8-10-24(35-22)12-14-26-16-18-28(37-26)30(31)32/h2-3,8-11,16-19H,1H3 |
| InChIKey | XLNIFIQUFNELKX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|